C19H29N3O6 — CID 173486879
(3S,6S)-5-azido-4-butoxy-6-methoxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-ol (PubChem CID 173486879) has the molecular formula C19H29N3O6 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3S,6S)-5-azido-4-butoxy-6-methoxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-ol.
| Compound Name | (3S,6S)-5-azido-4-butoxy-6-methoxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-ol |
|---|---|
| PubChem CID | 173486879 |
| Molecular Formula | C19H29N3O6 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (3S,6S)-5-azido-4-butoxy-6-methoxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-ol |
| SMILES | CCCCOC1C(N=[N+]=[N-])[C@@H](OC)OC(COCc2ccc(OC)cc2)[C@H]1O |
| InChI | InChI=1S/C19H29N3O6/c1-4-5-10-27-18-16(21-22-20)19(25-3)28-15(17(18)23)12-26-11-13-6-8-14(24-2)9-7-13/h6-9,15-19,23H,4-5,10-12H2,1-3H3/t15?,16?,17-,18?,19+/m1/s1 |
| InChIKey | BKCUYJBLSUEVPT-ORAQKYPQSA-N |
| XLogP | 2.81 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|