C36H41N3O5Si — CID 102322669
(2R,3R,4R,5R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 102322669) has the molecular formula C36H41N3O5Si and a molecular weight of 623.83 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4R,5R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 102322669 |
| Molecular Formula | C36H41N3O5Si |
| Molecular Weight | 623.83 g/mol |
| Exact Mass | 623.28 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CC(C)(C)[Si](O[C@@H]1O[C@H](COCc2ccccc2)[C@H](O)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H41N3O5Si/c1-36(2,3)45(29-20-12-6-13-21-29,30-22-14-7-15-23-30)44-35-32(38-39-37)34(42-25-28-18-10-5-11-19-28)33(40)31(43-35)26-41-24-27-16-8-4-9-17-27/h4-23,31-35,40H,24-26H2,1-3H3/t31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | XZKFHXNCJJAYPZ-KJQSSVQNSA-N |
| XLogP | 6.13 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.83 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|