C27H33NO7S — CID 58654945
[(3R,4R,6S)-5-acetamido-6-(4-methoxyphenyl)sulfanyl-2-(phenylmethoxymethyl)-4-prop-2-enoxyoxan-3-yl] acetate (PubChem CID 58654945) has the molecular formula C27H33NO7S and a molecular weight of 515.63 g/mol. Its IUPAC name is [(3R,4R,6S)-5-acetamido-6-(4-methoxyphenyl)sulfanyl-2-(phenylmethoxymethyl)-4-prop-2-enoxyoxan-3-yl] acetate.
| Compound Name | [(3R,4R,6S)-5-acetamido-6-(4-methoxyphenyl)sulfanyl-2-(phenylmethoxymethyl)-4-prop-2-enoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 58654945 |
| Molecular Formula | C27H33NO7S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | [(3R,4R,6S)-5-acetamido-6-(4-methoxyphenyl)sulfanyl-2-(phenylmethoxymethyl)-4-prop-2-enoxyoxan-3-yl] acetate |
| SMILES | C=CCO[C@@H]1C(NC(C)=O)[C@H](Sc2ccc(OC)cc2)OC(COCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H33NO7S/c1-5-15-33-26-24(28-18(2)29)27(36-22-13-11-21(31-4)12-14-22)35-23(25(26)34-19(3)30)17-32-16-20-9-7-6-8-10-20/h5-14,23-27H,1,15-17H2,2-4H3,(H,28,29)/t23?,24?,25-,26+,27-/m0/s1 |
| InChIKey | BSAALCDUUPHTBH-DTZJTSAQSA-N |
| XLogP | 3.74 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|