C14H19N3O9 — CID 70948130
[(3R,6R)-3,5,6-triacetyloxy-4-azidooxan-2-yl]methyl acetate (PubChem CID 70948130) has the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. Its IUPAC name is [(3R,6R)-3,5,6-triacetyloxy-4-azidooxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,5,6-triacetyloxy-4-azidooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70948130 |
| Molecular Formula | C14H19N3O9 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | [(3R,6R)-3,5,6-triacetyloxy-4-azidooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](OC(C)=O)C(OC(C)=O)C(N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H19N3O9/c1-6(18)22-5-10-12(23-7(2)19)11(16-17-15)13(24-8(3)20)14(26-10)25-9(4)21/h10-14H,5H2,1-4H3/t10?,11?,12-,13?,14-/m0/s1 |
| InChIKey | LJICGUPPWNZTFT-GPCCPQHFSA-N |
| XLogP | 0.38 |
| TPSA | 163.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|