C15H19N3O7 — CID 170219424
[(2R,3R,5R,6R)-3,5-diacetyloxy-4-azido-6-propa-1,2-dienyloxan-2-yl]methyl acetate (PubChem CID 170219424) has the molecular formula C15H19N3O7 and a molecular weight of 353.33 g/mol. Its IUPAC name is [(2R,3R,5R,6R)-3,5-diacetyloxy-4-azido-6-propa-1,2-dienyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,5R,6R)-3,5-diacetyloxy-4-azido-6-propa-1,2-dienyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 170219424 |
| Molecular Formula | C15H19N3O7 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [(2R,3R,5R,6R)-3,5-diacetyloxy-4-azido-6-propa-1,2-dienyloxan-2-yl]methyl acetate |
| SMILES | C=C=C[C@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)C(N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H19N3O7/c1-5-6-11-14(23-9(3)20)13(17-18-16)15(24-10(4)21)12(25-11)7-22-8(2)19/h6,11-15H,1,7H2,2-4H3/t11-,12-,13?,14+,15+/m1/s1 |
| InChIKey | QERPWVMXKKHQQV-XQYPFIQKSA-N |
| XLogP | 1.20 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|