C13H19N3O7 — CID 118352385
[(3S,6S)-4,6-diacetyloxy-5-azido-3-methyloxan-2-yl]methyl acetate (PubChem CID 118352385) has the molecular formula C13H19N3O7 and a molecular weight of 329.31 g/mol. Its IUPAC name is [(3S,6S)-4,6-diacetyloxy-5-azido-3-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,6S)-4,6-diacetyloxy-5-azido-3-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118352385 |
| Molecular Formula | C13H19N3O7 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [(3S,6S)-4,6-diacetyloxy-5-azido-3-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OC(C)=O)C(N=[N+]=[N-])C(OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C13H19N3O7/c1-6-10(5-20-7(2)17)23-13(22-9(4)19)11(15-16-14)12(6)21-8(3)18/h6,10-13H,5H2,1-4H3/t6-,10?,11?,12?,13-/m1/s1 |
| InChIKey | MNAJFEMGPWAUDZ-LREQSVORSA-N |
| XLogP | 1.08 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|