C22H36N6O9 — CID 123363740
[(3S,4S)-6-acetyloxy-5-azido-3,4-dimethyloxan-2-yl]methyl acetate;[(3S,4S)-5-azido-6-hydroxy-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 123363740) has the molecular formula C22H36N6O9 and a molecular weight of 528.56 g/mol. Its IUPAC name is [(3S,4S)-6-acetyloxy-5-azido-3,4-dimethyloxan-2-yl]methyl acetate;[(3S,4S)-5-azido-6-hydroxy-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S)-6-acetyloxy-5-azido-3,4-dimethyloxan-2-yl]methyl acetate;[(3S,4S)-5-azido-6-hydroxy-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123363740 |
| Molecular Formula | C22H36N6O9 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | [(3S,4S)-6-acetyloxy-5-azido-3,4-dimethyloxan-2-yl]methyl acetate;[(3S,4S)-5-azido-6-hydroxy-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(O)C(N=[N+]=[N-])[C@@H](C)[C@@H]1C.CC(=O)OCC1OC(OC(C)=O)C(N=[N+]=[N-])[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C12H19N3O5.C10H17N3O4/c1-6-7(2)11(14-15-13)12(19-9(4)17)20-10(6)5-18-8(3)16;1-5-6(2)9(12-13-11)10(15)17-8(5)4-16-7(3)14/h6-7,10-12H,5H2,1-4H3;5-6,8-10,15H,4H2,1-3H3/t6-,7-,10?,11?,12?;5-,6-,8?,9?,10?/m00/s1 |
| InChIKey | GBTOILIQNXXEDJ-NWHPLYEBSA-N |
| XLogP | 3.01 |
| TPSA | 215.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|