C13H19N3O6 — CID 157229779
[(3S,4R)-4-acetyloxy-5-azido-6-hydroxy-3-prop-1-enyloxan-2-yl]methyl acetate (PubChem CID 157229779) has the molecular formula C13H19N3O6 and a molecular weight of 313.31 g/mol. Its IUPAC name is [(3S,4R)-4-acetyloxy-5-azido-6-hydroxy-3-prop-1-enyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,4R)-4-acetyloxy-5-azido-6-hydroxy-3-prop-1-enyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 157229779 |
| Molecular Formula | C13H19N3O6 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [(3S,4R)-4-acetyloxy-5-azido-6-hydroxy-3-prop-1-enyloxan-2-yl]methyl acetate |
| SMILES | CC=C[C@@H]1C(COC(C)=O)OC(O)C(N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H19N3O6/c1-4-5-9-10(6-20-7(2)17)22-13(19)11(15-16-14)12(9)21-8(3)18/h4-5,9-13,19H,6H2,1-3H3/t9-,10?,11?,12-,13?/m1/s1 |
| InChIKey | HQJGUGIUJPTIRZ-IELNECDZSA-N |
| XLogP | 1.07 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|