C14H22N4O8 — CID 102499824
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-azido-6-[methoxy(methyl)amino]oxan-2-yl]methyl acetate (PubChem CID 102499824) has the molecular formula C14H22N4O8 and a molecular weight of 374.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-azido-6-[methoxy(methyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-azido-6-[methoxy(methyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102499824 |
| Molecular Formula | C14H22N4O8 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-azido-6-[methoxy(methyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CON(C)[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H22N4O8/c1-7(19)23-6-10-12(24-8(2)20)13(25-9(3)21)11(16-17-15)14(26-10)18(4)22-5/h10-14H,6H2,1-5H3/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | RMZDILWARUNJKH-DHGKCCLASA-N |
| XLogP | 0.31 |
| TPSA | 149.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|