C12H16N4O10 — CID 54550672
[(2R,3S,4R,5S,6S)-3,4-diacetyloxy-5-azido-6-nitrooxyoxan-2-yl]methyl acetate (PubChem CID 54550672) has the molecular formula C12H16N4O10 and a molecular weight of 376.28 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-5-azido-6-nitrooxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-5-azido-6-nitrooxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54550672 |
| Molecular Formula | C12H16N4O10 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-5-azido-6-nitrooxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[N+](=O)[O-])[C@@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H16N4O10/c1-5(17)22-4-8-10(23-6(2)18)11(24-7(3)19)9(14-15-13)12(25-8)26-16(20)21/h8-12H,4H2,1-3H3/t8-,9+,10-,11-,12+/m1/s1 |
| InChIKey | ZJRHNHIEORAKEY-ROHXPCBUSA-N |
| XLogP | 0.03 |
| TPSA | 189.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|