C10H16N4O6 — CID 174153753
[(2R,3S,4S,5R)-5-azido-2-ethyl-3-methyl-6-nitrooxyoxan-4-yl] acetate (PubChem CID 174153753) has the molecular formula C10H16N4O6 and a molecular weight of 288.26 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-azido-2-ethyl-3-methyl-6-nitrooxyoxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-5-azido-2-ethyl-3-methyl-6-nitrooxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 174153753 |
| Molecular Formula | C10H16N4O6 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | [(2R,3S,4S,5R)-5-azido-2-ethyl-3-methyl-6-nitrooxyoxan-4-yl] acetate |
| SMILES | CC[C@H]1OC(O[N+](=O)[O-])[C@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@H]1C |
| InChI | InChI=1S/C10H16N4O6/c1-4-7-5(2)9(18-6(3)15)8(12-13-11)10(19-7)20-14(16)17/h5,7-10H,4H2,1-3H3/t5-,7+,8+,9-,10?/m0/s1 |
| InChIKey | IRJKBMTWBKQDFQ-RAJNDVKXSA-N |
| XLogP | 1.58 |
| TPSA | 136.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|