C16H28N4O8Si — CID 11362490
[(4aR,7S,8R,8aS)-7-azido-2,2-ditert-butyl-6-nitrooxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate (PubChem CID 11362490) has the molecular formula C16H28N4O8Si and a molecular weight of 432.51 g/mol. Its IUPAC name is [(4aR,7S,8R,8aS)-7-azido-2,2-ditert-butyl-6-nitrooxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate.
| Compound Name | [(4aR,7S,8R,8aS)-7-azido-2,2-ditert-butyl-6-nitrooxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate |
|---|---|
| PubChem CID | 11362490 |
| Molecular Formula | C16H28N4O8Si |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [(4aR,7S,8R,8aS)-7-azido-2,2-ditert-butyl-6-nitrooxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]2OC(O[N+](=O)[O-])[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C16H28N4O8Si/c1-9(21)25-13-11(18-19-17)14(27-20(22)23)26-10-8-24-29(15(2,3)4,16(5,6)7)28-12(10)13/h10-14H,8H2,1-7H3/t10-,11+,12-,13-,14?/m1/s1 |
| InChIKey | VBDOSUIZVJQCME-DYPLGBCKSA-N |
| XLogP | 2.99 |
| TPSA | 155.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|