C8H11N3O5 — CID 12904933
(4-azido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl) acetate (PubChem CID 12904933) has the molecular formula C8H11N3O5 and a molecular weight of 229.19 g/mol. Its IUPAC name is (4-azido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl) acetate.
| Compound Name | (4-azido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl) acetate |
|---|---|
| PubChem CID | 12904933 |
| Molecular Formula | C8H11N3O5 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (4-azido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl) acetate |
| SMILES | CC(=O)OC1C(O)C2COC(O2)C1N=[N+]=[N-] |
| InChI | InChI=1S/C8H11N3O5/c1-3(12)15-7-5(10-11-9)8-14-2-4(16-8)6(7)13/h4-8,13H,2H2,1H3 |
| InChIKey | KDQSFTBUIPKTIA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|