C14H25N3O5Si — CID 71180018
[(1S,2S,4S)-4-azido-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate (PubChem CID 71180018) has the molecular formula C14H25N3O5Si and a molecular weight of 343.46 g/mol. Its IUPAC name is [(1S,2S,4S)-4-azido-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate.
| Compound Name | [(1S,2S,4S)-4-azido-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
|---|---|
| PubChem CID | 71180018 |
| Molecular Formula | C14H25N3O5Si |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(1S,2S,4S)-4-azido-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@H](N=[N+]=[N-])C2OC[C@@H](O2)[C@H]1CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C14H25N3O5Si/c1-8(18)21-12-9(6-14(2,3)23(4,5)19)10-7-20-13(22-10)11(12)16-17-15/h9-13,19H,6-7H2,1-5H3/t9-,10-,11+,12?,13?/m1/s1 |
| InChIKey | CNDCXAHWZOTENH-VFPQWFPESA-N |
| XLogP | 2.34 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|