C8H10ClN3O5 — CID 10491818
[(1R,2S,3R,4R,5R)-4-azido-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] 2-chloroacetate (PubChem CID 10491818) has the molecular formula C8H10ClN3O5 and a molecular weight of 263.64 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-4-azido-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] 2-chloroacetate.
| Compound Name | [(1R,2S,3R,4R,5R)-4-azido-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 10491818 |
| Molecular Formula | C8H10ClN3O5 |
| Molecular Weight | 263.64 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-4-azido-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] 2-chloroacetate |
| SMILES | [N-]=[N+]=N[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](OC(=O)CCl)[C@@H]1O |
| InChI | InChI=1S/C8H10ClN3O5/c9-1-4(13)17-7-3-2-15-8(16-3)5(6(7)14)11-12-10/h3,5-8,14H,1-2H2/t3-,5-,6-,7-,8-/m1/s1 |
| InChIKey | BQXWDRNZFUFQCO-PNAXYBNRSA-N |
| XLogP | -0.07 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.64 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|