C15H25N3O6 — CID 167566265
(2S,3R,5R)-2-[(2R,4S,5S)-3-azido-6-(hydroxymethyl)-4,5-dimethyloxan-2-yl]oxy-3-methyl-6,8-dioxabicyclo[3.2.1]octan-4-ol (PubChem CID 167566265) has the molecular formula C15H25N3O6 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2S,3R,5R)-2-[(2R,4S,5S)-3-azido-6-(hydroxymethyl)-4,5-dimethyloxan-2-yl]oxy-3-methyl-6,8-dioxabicyclo[3.2.1]octan-4-ol.
| Compound Name | (2S,3R,5R)-2-[(2R,4S,5S)-3-azido-6-(hydroxymethyl)-4,5-dimethyloxan-2-yl]oxy-3-methyl-6,8-dioxabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 167566265 |
| Molecular Formula | C15H25N3O6 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (2S,3R,5R)-2-[(2R,4S,5S)-3-azido-6-(hydroxymethyl)-4,5-dimethyloxan-2-yl]oxy-3-methyl-6,8-dioxabicyclo[3.2.1]octan-4-ol |
| SMILES | C[C@@H]1C(CO)O[C@H](O[C@@H]2C3CO[C@H](O3)C(O)[C@H]2C)C(N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C15H25N3O6/c1-6-7(2)11(17-18-16)14(22-9(6)4-19)24-13-8(3)12(20)15-21-5-10(13)23-15/h6-15,19-20H,4-5H2,1-3H3/t6-,7-,8+,9?,10?,11?,12?,13-,14+,15+/m0/s1 |
| InChIKey | FICVCBYOGYHOLG-XDKCHYSSSA-N |
| XLogP | 0.79 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|