C8H14O3 — CID 131176478
(1S,2S,3R,4S,5R)-2,3-dimethyl-6,8-dioxabicyclo[3.2.1]octan-4-ol (PubChem CID 131176478) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (1S,2S,3R,4S,5R)-2,3-dimethyl-6,8-dioxabicyclo[3.2.1]octan-4-ol.
| Compound Name | (1S,2S,3R,4S,5R)-2,3-dimethyl-6,8-dioxabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 131176478 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (1S,2S,3R,4S,5R)-2,3-dimethyl-6,8-dioxabicyclo[3.2.1]octan-4-ol |
| SMILES | C[C@@H]1[C@H](C)[C@H]2CO[C@H](O2)[C@H]1O |
| InChI | InChI=1S/C8H14O3/c1-4-5(2)7(9)8-10-3-6(4)11-8/h4-9H,3H2,1-2H3/t4-,5+,6+,7-,8+/m0/s1 |
| InChIKey | CUVKXQGWUXQLBQ-FMGWEMOISA-N |
| XLogP | 0.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |