C8H13NO5 — CID 57197157
N-[(1R,2R,3S,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]acetamide (PubChem CID 57197157) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is N-[(1R,2R,3S,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]acetamide.
| Compound Name | N-[(1R,2R,3S,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]acetamide |
|---|---|
| PubChem CID | 57197157 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | N-[(1R,2R,3S,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](O)[C@H]2CO[C@H](O2)[C@@H]1O |
| InChI | InChI=1S/C8H13NO5/c1-3(10)9-5-6(11)4-2-13-8(14-4)7(5)12/h4-8,11-12H,2H2,1H3,(H,9,10)/t4-,5+,6+,7-,8-/m1/s1 |
| InChIKey | TWDDETOCLAWUAT-DWOUCZDBSA-N |
| XLogP | -2.03 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |