C15H24N2O8 — CID 10428580
N-[(1S,2R,3S,4R,5R)-3-hydroxy-2-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 10428580) has the molecular formula C15H24N2O8 and a molecular weight of 360.36 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R,5R)-3-hydroxy-2-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,3S,4R,5R)-3-hydroxy-2-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 10428580 |
| Molecular Formula | C15H24N2O8 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[(1S,2R,3S,4R,5R)-3-hydroxy-2-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H]2OC[C@@H](O2)[C@H](N[C@H]2C=C(CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O |
| InChI | InChI=1S/C15H24N2O8/c1-5(19)16-10-13(22)9(8-4-24-15(10)25-8)17-7-2-6(3-18)11(20)14(23)12(7)21/h2,7-15,17-18,20-23H,3-4H2,1H3,(H,16,19)/t7-,8+,9-,10+,11+,12-,13-,14-,15+/m0/s1 |
| InChIKey | USTYJTMYFSMHSY-IYJKLEIUSA-N |
| XLogP | -4.05 |
| TPSA | 160.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|