C9H14FNO4 — CID 146398606
N-[(1S,4R,5S,6S)-3-(fluoromethyl)-4,5,6-trihydroxycyclohex-2-en-1-yl]acetamide (PubChem CID 146398606) has the molecular formula C9H14FNO4 and a molecular weight of 219.21 g/mol. Its IUPAC name is N-[(1S,4R,5S,6S)-3-(fluoromethyl)-4,5,6-trihydroxycyclohex-2-en-1-yl]acetamide.
| Compound Name | N-[(1S,4R,5S,6S)-3-(fluoromethyl)-4,5,6-trihydroxycyclohex-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 146398606 |
| Molecular Formula | C9H14FNO4 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-[(1S,4R,5S,6S)-3-(fluoromethyl)-4,5,6-trihydroxycyclohex-2-en-1-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C=C(CF)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H14FNO4/c1-4(12)11-6-2-5(3-10)7(13)9(15)8(6)14/h2,6-9,13-15H,3H2,1H3,(H,11,12)/t6-,7+,8-,9-/m0/s1 |
| InChIKey | LWDHTQSOAOUPFI-KZVJFYERSA-N |
| XLogP | -1.52 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|