C13H25NO6 — CID 91094238
pentane;[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]carbamic acid (PubChem CID 91094238) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is pentane;[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]carbamic acid.
| Compound Name | pentane;[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]carbamic acid |
|---|---|
| PubChem CID | 91094238 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | pentane;[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]carbamic acid |
| SMILES | CCCCC.O=C(O)NC1C=C(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C8H13NO6.C5H12/c10-2-3-1-4(9-8(14)15)6(12)7(13)5(3)11;1-3-5-4-2/h1,4-7,9-13H,2H2,(H,14,15);3-5H2,1-2H3 |
| InChIKey | YFKGUJOZSSOGFA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|