C18H35NO2Sn — CID 68586998
(3-tributylstannylcyclopent-2-en-1-yl)carbamic acid (PubChem CID 68586998) has the molecular formula C18H35NO2Sn and a molecular weight of 416.19 g/mol. Its IUPAC name is (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid.
| Compound Name | (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid |
|---|---|
| PubChem CID | 68586998 |
| Molecular Formula | C18H35NO2Sn |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC(NC(=O)O)CC1 |
| InChI | InChI=1S/C6H8NO2.3C4H9.Sn/c8-6(9)7-5-3-1-2-4-5;3*1-3-4-2;/h4-5,7H,1,3H2,(H,8,9);3*1,3-4H2,2H3; |
| InChIKey | CWMYOUWCSZRTHV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |