(3-tributylstannylcyclopent-2-en-1-yl)carbamic acid

C18H35NO2Sn — CID 68586998

IUPAC(3-tributylstannylcyclopent-2-en-1-yl)carbamic acid
SMILESCCCC[Sn](CCCC)(CCCC)C1=CC(NC(=O)O)CC1
InChIInChI=1S/C6H8NO2.3C4H9.Sn/c8-6(9)7-5-3-1-2-4-5;3*1-3-4-2;/h4-5,7H,1,3H2,(H,8,9);3*1,3-4H2,2H3;
InChIKeyCWMYOUWCSZRTHV-UHFFFAOYSA-N
MW416.19 g/mol
LogP5.73
Rot. Bonds11

About (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid

(3-tributylstannylcyclopent-2-en-1-yl)carbamic acid (PubChem CID 68586998) has the molecular formula C18H35NO2Sn and a molecular weight of 416.19 g/mol. Its IUPAC name is (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid.

Molecular Properties

Compound Name(3-tributylstannylcyclopent-2-en-1-yl)carbamic acid
PubChem CID68586998
Molecular FormulaC18H35NO2Sn
Molecular Weight416.19 g/mol
Exact Mass417.17
IUPAC Name(3-tributylstannylcyclopent-2-en-1-yl)carbamic acid
SMILESCCCC[Sn](CCCC)(CCCC)C1=CC(NC(=O)O)CC1
InChIInChI=1S/C6H8NO2.3C4H9.Sn/c8-6(9)7-5-3-1-2-4-5;3*1-3-4-2;/h4-5,7H,1,3H2,(H,8,9);3*1,3-4H2,2H3;
InChIKeyCWMYOUWCSZRTHV-UHFFFAOYSA-N
XLogP5.73
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds11
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500416.19
LogP ≤ 55.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid?
The IUPAC name of (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid (CID 68586998) is (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid.
What is the SMILES notation for (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid?
The canonical SMILES for (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid is CCCC[Sn](CCCC)(CCCC)C1=CC(NC(=O)O)CC1.
What is the InChIKey of (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid?
The InChIKey is CWMYOUWCSZRTHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NO2.3C4H9.Sn/c8-6(9)7-5-3-1-2-4-5;3*1-3-4-2;/h4-5,7H,1,3H2,(H,8,9);3*1,3-4H2,2H3;.
What are the key properties of (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid?
(3-tributylstannylcyclopent-2-en-1-yl)carbamic acid has a molecular weight of 416.19 g/mol, XLogP of 5.73, 11 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tributylstannylcyclopent-2-en-1-yl)carbamic acid is sourced from PubChem (CID 68586998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).