C20H36O2SSn — CID 156849763
ethyl 3-tributylstannyl-2H-thiopyran-6-carboxylate (PubChem CID 156849763) has the molecular formula C20H36O2SSn and a molecular weight of 459.28 g/mol. Its IUPAC name is ethyl 3-tributylstannyl-2H-thiopyran-6-carboxylate.
| Compound Name | ethyl 3-tributylstannyl-2H-thiopyran-6-carboxylate |
|---|---|
| PubChem CID | 156849763 |
| Molecular Formula | C20H36O2SSn |
| Molecular Weight | 459.28 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | ethyl 3-tributylstannyl-2H-thiopyran-6-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC=C(C(=O)OCC)SC1 |
| InChI | InChI=1S/C8H9O2S.3C4H9.Sn/c1-2-10-8(9)7-5-3-4-6-11-7;3*1-3-4-2;/h3,5H,2,6H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | QKFYJVLOTGSFGB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.28 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |