C25H40O3Sn — CID 10874848
benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 10874848) has the molecular formula C25H40O3Sn and a molecular weight of 507.30 g/mol. Its IUPAC name is benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 10874848 |
| Molecular Formula | C25H40O3Sn |
| Molecular Weight | 507.30 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=C(C(=O)OCc2ccccc2)CCCO1 |
| InChI | InChI=1S/C13H13O3.3C4H9.Sn/c14-13(12-7-4-8-15-10-12)16-9-11-5-2-1-3-6-11;3*1-3-4-2;/h1-3,5-6H,4,7-9H2;3*1,3-4H2,2H3; |
| InChIKey | AIYYSUXBCSGDGJ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.30 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |