benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate

C25H40O3Sn — CID 10874848

IUPACbenzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate
SMILESCCCC[Sn](CCCC)(CCCC)C1=C(C(=O)OCc2ccccc2)CCCO1
InChIInChI=1S/C13H13O3.3C4H9.Sn/c14-13(12-7-4-8-15-10-12)16-9-11-5-2-1-3-6-11;3*1-3-4-2;/h1-3,5-6H,4,7-9H2;3*1,3-4H2,2H3;
InChIKeyAIYYSUXBCSGDGJ-UHFFFAOYSA-N
MW507.30 g/mol
LogP7.18
Rot. Bonds13

About benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate

benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 10874848) has the molecular formula C25H40O3Sn and a molecular weight of 507.30 g/mol. Its IUPAC name is benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate.

Molecular Properties

Compound Namebenzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate
PubChem CID10874848
Molecular FormulaC25H40O3Sn
Molecular Weight507.30 g/mol
Exact Mass508.20
IUPAC Namebenzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate
SMILESCCCC[Sn](CCCC)(CCCC)C1=C(C(=O)OCc2ccccc2)CCCO1
InChIInChI=1S/C13H13O3.3C4H9.Sn/c14-13(12-7-4-8-15-10-12)16-9-11-5-2-1-3-6-11;3*1-3-4-2;/h1-3,5-6H,4,7-9H2;3*1,3-4H2,2H3;
InChIKeyAIYYSUXBCSGDGJ-UHFFFAOYSA-N
XLogP7.18
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds13
Heavy Atoms29
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500507.30
LogP ≤ 57.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate?
The IUPAC name of benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate (CID 10874848) is benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate.
What is the SMILES notation for benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate?
The canonical SMILES for benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate is CCCC[Sn](CCCC)(CCCC)C1=C(C(=O)OCc2ccccc2)CCCO1.
What is the InChIKey of benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate?
The InChIKey is AIYYSUXBCSGDGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13O3.3C4H9.Sn/c14-13(12-7-4-8-15-10-12)16-9-11-5-2-1-3-6-11;3*1-3-4-2;/h1-3,5-6H,4,7-9H2;3*1,3-4H2,2H3;.
What are the key properties of benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate?
benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate has a molecular weight of 507.30 g/mol, XLogP of 7.18, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 6-tributylstannyl-3,4-dihydro-2H-pyran-5-carboxylate is sourced from PubChem (CID 10874848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).