C30H36O8Sn — CID 16684136
1-O-benzyl 4-O-[dibutyl-[(Z)-4-oxo-4-phenylmethoxybut-2-enoyl]oxystannyl] (Z)-but-2-enedioate (PubChem CID 16684136) has the molecular formula C30H36O8Sn and a molecular weight of 643.32 g/mol. Its IUPAC name is 1-O-benzyl 4-O-[dibutyl-[(Z)-4-oxo-4-phenylmethoxybut-2-enoyl]oxystannyl] (Z)-but-2-enedioate.
| Compound Name | 1-O-benzyl 4-O-[dibutyl-[(Z)-4-oxo-4-phenylmethoxybut-2-enoyl]oxystannyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 16684136 |
| Molecular Formula | C30H36O8Sn |
| Molecular Weight | 643.32 g/mol |
| Exact Mass | 644.14 |
| IUPAC Name | 1-O-benzyl 4-O-[dibutyl-[(Z)-4-oxo-4-phenylmethoxybut-2-enoyl]oxystannyl] (Z)-but-2-enedioate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)/C=C\C(=O)OCc1ccccc1)OC(=O)/C=C\C(=O)OCc1ccccc1 |
| InChI | InChI=1S/2C11H10O4.2C4H9.Sn/c2*12-10(13)6-7-11(14)15-8-9-4-2-1-3-5-9;2*1-3-4-2;/h2*1-7H,8H2,(H,12,13);2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*7-6-;;; |
| InChIKey | TUALPPJDVFLVNQ-KUAKSMGGSA-L |
| XLogP | 5.71 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.32 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|