About benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate
benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate (PubChem CID 59772895) has the molecular formula C21H24O4
and a molecular weight of 340.42 g/mol. Its IUPAC name is benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate.
Molecular Properties
| Compound Name | benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate |
| PubChem CID | 59772895 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate |
| SMILES | CCCCC1(c2ccc(C(=O)OCc3ccccc3)cc2)OCCO1 |
| InChI | InChI=1S/C21H24O4/c1-2-3-13-21(24-14-15-25-21)19-11-9-18(10-12-19)20(22)23-16-17-7-5-4-6-8-17/h4-12H,2-3,13-16H2,1H3 |
| InChIKey | XDKHTQFIAFOUMH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate?
The IUPAC name of benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate (CID 59772895) is benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate.
What is the SMILES notation for benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate?
The canonical SMILES for benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate is CCCCC1(c2ccc(C(=O)OCc3ccccc3)cc2)OCCO1.
What is the InChIKey of benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate?
The InChIKey is XDKHTQFIAFOUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O4/c1-2-3-13-21(24-14-15-25-21)19-11-9-18(10-12-19)20(22)23-16-17-7-5-4-6-8-17/h4-12H,2-3,13-16H2,1H3.
What are the key properties of benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate?
benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate has a molecular weight of 340.42 g/mol, XLogP of 4.43, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(2-butyl-1,3-dioxolan-2-yl)benzoate is sourced from PubChem (CID 59772895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).