C17H18O4S — CID 102394069
diethyl (2Z,5Z)-4-thiabicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaene-3,5-dicarboxylate (PubChem CID 102394069) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is diethyl (2Z,5Z)-4-thiabicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaene-3,5-dicarboxylate.
| Compound Name | diethyl (2Z,5Z)-4-thiabicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaene-3,5-dicarboxylate |
|---|---|
| PubChem CID | 102394069 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | diethyl (2Z,5Z)-4-thiabicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaene-3,5-dicarboxylate |
| SMILES | CCOC(=O)/C1=C/C2=CC=CC=C(/C=C(/C(=O)OCC)S1)C2 |
| InChI | InChI=1S/C17H18O4S/c1-3-20-16(18)14-10-12-7-5-6-8-13(9-12)11-15(22-14)17(19)21-4-2/h5-8,10-11H,3-4,9H2,1-2H3/b14-10-,15-11- |
| InChIKey | KHMWBOIHIGODIX-HYQBVQLESA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |