C7H11NO2S — CID 131075691
ethyl (3S)-3-amino-2,3-dihydrothiophene-5-carboxylate (PubChem CID 131075691) has the molecular formula C7H11NO2S and a molecular weight of 173.24 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2,3-dihydrothiophene-5-carboxylate.
| Compound Name | ethyl (3S)-3-amino-2,3-dihydrothiophene-5-carboxylate |
|---|---|
| PubChem CID | 131075691 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | ethyl (3S)-3-amino-2,3-dihydrothiophene-5-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H](N)CS1 |
| InChI | InChI=1S/C7H11NO2S/c1-2-10-7(9)6-3-5(8)4-11-6/h3,5H,2,4,8H2,1H3/t5-/m0/s1 |
| InChIKey | ZJWVYBPSTOSHEM-YFKPBYRVSA-N |
| XLogP | 0.51 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |