C9H11NO2S — CID 88759007
ethyl 2-amino-5-sulfanylidenecyclohexa-1,3-diene-1-carboxylate (PubChem CID 88759007) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is ethyl 2-amino-5-sulfanylidenecyclohexa-1,3-diene-1-carboxylate.
| Compound Name | ethyl 2-amino-5-sulfanylidenecyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 88759007 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | ethyl 2-amino-5-sulfanylidenecyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(N)C=CC(=S)C1 |
| InChI | InChI=1S/C9H11NO2S/c1-2-12-9(11)7-5-6(13)3-4-8(7)10/h3-4H,2,5,10H2,1H3 |
| InChIKey | ZXOMJQKUYXGIPC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|