C11H13NO2 — CID 143685503
ethyl (1Z,3Z,5Z,7Z)-2-aminocycloocta-1,3,5,7-tetraene-1-carboxylate (PubChem CID 143685503) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is ethyl (1Z,3Z,5Z,7Z)-2-aminocycloocta-1,3,5,7-tetraene-1-carboxylate.
| Compound Name | ethyl (1Z,3Z,5Z,7Z)-2-aminocycloocta-1,3,5,7-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 143685503 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | ethyl (1Z,3Z,5Z,7Z)-2-aminocycloocta-1,3,5,7-tetraene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(N)/C=C\C=C/C=C\1 |
| InChI | InChI=1S/C11H13NO2/c1-2-14-11(13)9-7-5-3-4-6-8-10(9)12/h3-8H,2,12H2,1H3/b4-3-,5-3-,6-4-,7-5-,8-6-,9-7+,10-8+,10-9- |
| InChIKey | SDMHMWPDBDNCHL-OSNHOXBNSA-N |
| XLogP | 1.44 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |