C9H13ClN2O2 — CID 177020997
ethyl 3-amino-2-chloro-6-methyl-1,2-dihydropyridine-4-carboxylate (PubChem CID 177020997) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is ethyl 3-amino-2-chloro-6-methyl-1,2-dihydropyridine-4-carboxylate.
| Compound Name | ethyl 3-amino-2-chloro-6-methyl-1,2-dihydropyridine-4-carboxylate |
|---|---|
| PubChem CID | 177020997 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | ethyl 3-amino-2-chloro-6-methyl-1,2-dihydropyridine-4-carboxylate |
| SMILES | CCOC(=O)C1=C(N)C(Cl)NC(C)=C1 |
| InChI | InChI=1S/C9H13ClN2O2/c1-3-14-9(13)6-4-5(2)12-8(10)7(6)11/h4,8,12H,3,11H2,1-2H3 |
| InChIKey | WVKXJIHPZVJTPT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|