C16H22N2O8 — CID 154144676
tetraethyl 1,4-dihydropyrazine-2,3,5,6-tetracarboxylate (PubChem CID 154144676) has the molecular formula C16H22N2O8 and a molecular weight of 370.36 g/mol. Its IUPAC name is tetraethyl 1,4-dihydropyrazine-2,3,5,6-tetracarboxylate.
| Compound Name | tetraethyl 1,4-dihydropyrazine-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 154144676 |
| Molecular Formula | C16H22N2O8 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | tetraethyl 1,4-dihydropyrazine-2,3,5,6-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)NC(C(=O)OCC)=C(C(=O)OCC)N1 |
| InChI | InChI=1S/C16H22N2O8/c1-5-23-13(19)9-10(14(20)24-6-2)18-12(16(22)26-8-4)11(17-9)15(21)25-7-3/h17-18H,5-8H2,1-4H3 |
| InChIKey | ZLWVRPOHIGWQQM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|