About ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate
ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate (PubChem CID 10631006) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate |
| PubChem CID | 10631006 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(=O)oc1C |
| InChI | InChI=1S/C7H9NO4/c1-3-11-6(9)5-4(2)12-7(10)8-5/h3H2,1-2H3,(H,8,10) |
| InChIKey | YVJUSFMTOGLAID-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate (CID 10631006) is ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate is CCOC(=O)c1[nH]c(=O)oc1C.
What is the InChIKey of ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate?
The InChIKey is YVJUSFMTOGLAID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-3-11-6(9)5-4(2)12-7(10)8-5/h3H2,1-2H3,(H,8,10).
What are the key properties of ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate?
ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate has a molecular weight of 171.15 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 10631006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).