C7H9NO4 — CID 10631006
ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate (PubChem CID 10631006) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 10631006 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | ethyl 5-methyl-2-oxo-3H-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(=O)oc1C |
| InChI | InChI=1S/C7H9NO4/c1-3-11-6(9)5-4(2)12-7(10)8-5/h3H2,1-2H3,(H,8,10) |
| InChIKey | YVJUSFMTOGLAID-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |