C12H17NO3 — CID 121001631
ethyl 5-acetyl-3-ethyl-4-methyl-1H-pyrrole-2-carboxylate (PubChem CID 121001631) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is ethyl 5-acetyl-3-ethyl-4-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 5-acetyl-3-ethyl-4-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 121001631 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | ethyl 5-acetyl-3-ethyl-4-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C(C)=O)c(C)c1CC |
| InChI | InChI=1S/C12H17NO3/c1-5-9-7(3)10(8(4)14)13-11(9)12(15)16-6-2/h13H,5-6H2,1-4H3 |
| InChIKey | HKGUCYPXKBIYHP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |