C20H25NO10 — CID 134831153
diethyl 2,5-bis(3-ethoxy-3-oxopropanoyl)-1H-pyrrole-3,4-dicarboxylate (PubChem CID 134831153) has the molecular formula C20H25NO10 and a molecular weight of 439.42 g/mol. Its IUPAC name is diethyl 2,5-bis(3-ethoxy-3-oxopropanoyl)-1H-pyrrole-3,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis(3-ethoxy-3-oxopropanoyl)-1H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 134831153 |
| Molecular Formula | C20H25NO10 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | diethyl 2,5-bis(3-ethoxy-3-oxopropanoyl)-1H-pyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)CC(=O)c1[nH]c(C(=O)CC(=O)OCC)c(C(=O)OCC)c1C(=O)OCC |
| InChI | InChI=1S/C20H25NO10/c1-5-28-13(24)9-11(22)17-15(19(26)30-7-3)16(20(27)31-8-4)18(21-17)12(23)10-14(25)29-6-2/h21H,5-10H2,1-4H3 |
| InChIKey | YIQBDKZETDSMSW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 155.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|