C9H12INO2 — CID 11529435
ethyl 4-iodo-2,5-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 11529435) has the molecular formula C9H12INO2 and a molecular weight of 293.10 g/mol. Its IUPAC name is ethyl 4-iodo-2,5-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-iodo-2,5-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 11529435 |
| Molecular Formula | C9H12INO2 |
| Molecular Weight | 293.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | ethyl 4-iodo-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C)c1I |
| InChI | InChI=1S/C9H12INO2/c1-4-13-9(12)7-5(2)11-6(3)8(7)10/h11H,4H2,1-3H3 |
| InChIKey | YXVZVJDLGXBSHI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.10 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|