About ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate
ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate (PubChem CID 11389644) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate.
Analyze ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate?
The IUPAC name of ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate (CID 11389644) is ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate.
What is the SMILES notation for ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate?
The canonical SMILES for ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate is CCOC(=O)c1c(C)[nH][nH]c1=O.
What is the InChIKey of ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate?
The InChIKey is CWADBBSOZFXYQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-3-12-7(11)5-4(2)8-9-6(5)10/h3H2,1-2H3,(H2,8,9,10).
What are the key properties of ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate?
ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate has a molecular weight of 170.17 g/mol, XLogP of 0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methyl-5-oxo-1,2-dihydropyrazole-4-carboxylate is sourced from PubChem (CID 11389644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).