C14H16N2O3 — CID 11129045
ethyl 3-oxo-5-(2-phenylethyl)-1,2-dihydropyrazole-4-carboxylate (PubChem CID 11129045) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is ethyl 3-oxo-5-(2-phenylethyl)-1,2-dihydropyrazole-4-carboxylate.
| Compound Name | ethyl 3-oxo-5-(2-phenylethyl)-1,2-dihydropyrazole-4-carboxylate |
|---|---|
| PubChem CID | 11129045 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | ethyl 3-oxo-5-(2-phenylethyl)-1,2-dihydropyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(CCc2ccccc2)[nH][nH]c1=O |
| InChI | InChI=1S/C14H16N2O3/c1-2-19-14(18)12-11(15-16-13(12)17)9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H2,15,16,17) |
| InChIKey | ULNWTQHSDSNDCG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |