C23H29NO4 — CID 53303921
ethyl 4-cycloheptyloxy-2-oxo-6-(2-phenylethyl)-1H-pyridine-3-carboxylate (PubChem CID 53303921) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 4-cycloheptyloxy-2-oxo-6-(2-phenylethyl)-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 4-cycloheptyloxy-2-oxo-6-(2-phenylethyl)-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 53303921 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | ethyl 4-cycloheptyloxy-2-oxo-6-(2-phenylethyl)-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(OC2CCCCCC2)cc(CCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C23H29NO4/c1-2-27-23(26)21-20(28-19-12-8-3-4-9-13-19)16-18(24-22(21)25)15-14-17-10-6-5-7-11-17/h5-7,10-11,16,19H,2-4,8-9,12-15H2,1H3,(H,24,25) |
| InChIKey | PGOUHWCSKDCRCR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |