C24H30O4 — CID 18008042
ethyl 2-(cyclohexylmethoxy)-6-methyl-4-phenylmethoxybenzoate (PubChem CID 18008042) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is ethyl 2-(cyclohexylmethoxy)-6-methyl-4-phenylmethoxybenzoate.
| Compound Name | ethyl 2-(cyclohexylmethoxy)-6-methyl-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 18008042 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | ethyl 2-(cyclohexylmethoxy)-6-methyl-4-phenylmethoxybenzoate |
| SMILES | CCOC(=O)c1c(C)cc(OCc2ccccc2)cc1OCC1CCCCC1 |
| InChI | InChI=1S/C24H30O4/c1-3-26-24(25)23-18(2)14-21(27-16-19-10-6-4-7-11-19)15-22(23)28-17-20-12-8-5-9-13-20/h4,6-7,10-11,14-15,20H,3,5,8-9,12-13,16-17H2,1-2H3 |
| InChIKey | IONILKJMORGLHT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |