C21H24O7 — CID 15812358
triethyl 5-(2-phenylethyl)furan-2,3,4-tricarboxylate (PubChem CID 15812358) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is triethyl 5-(2-phenylethyl)furan-2,3,4-tricarboxylate.
| Compound Name | triethyl 5-(2-phenylethyl)furan-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 15812358 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | triethyl 5-(2-phenylethyl)furan-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)c1oc(CCc2ccccc2)c(C(=O)OCC)c1C(=O)OCC |
| InChI | InChI=1S/C21H24O7/c1-4-25-19(22)16-15(13-12-14-10-8-7-9-11-14)28-18(21(24)27-6-3)17(16)20(23)26-5-2/h7-11H,4-6,12-13H2,1-3H3 |
| InChIKey | MQDIAFUVWIOLEA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|