C28H22BrNO3 — CID 13009940
ethyl 3-(10-bromoanthracen-9-yl)-5-(2-phenylethyl)-1,2-oxazole-4-carboxylate (PubChem CID 13009940) has the molecular formula C28H22BrNO3 and a molecular weight of 500.39 g/mol. Its IUPAC name is ethyl 3-(10-bromoanthracen-9-yl)-5-(2-phenylethyl)-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 3-(10-bromoanthracen-9-yl)-5-(2-phenylethyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 13009940 |
| Molecular Formula | C28H22BrNO3 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | ethyl 3-(10-bromoanthracen-9-yl)-5-(2-phenylethyl)-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2c3ccccc3c(Br)c3ccccc23)noc1CCc1ccccc1 |
| InChI | InChI=1S/C28H22BrNO3/c1-2-32-28(31)25-23(17-16-18-10-4-3-5-11-18)33-30-27(25)24-19-12-6-8-14-21(19)26(29)22-15-9-7-13-20(22)24/h3-15H,2,16-17H2,1H3 |
| InChIKey | QTCYVBJSDLAXLB-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|