C14H13NO4 — CID 102300604
ethyl 3-benzoyl-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 102300604) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is ethyl 3-benzoyl-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 3-benzoyl-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102300604 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | ethyl 3-benzoyl-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(=O)c2ccccc2)noc1C |
| InChI | InChI=1S/C14H13NO4/c1-3-18-14(17)11-9(2)19-15-12(11)13(16)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3 |
| InChIKey | RJGAWDZJIJBNER-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |