C14H14N2O4 — CID 57333911
ethyl 3-(methylcarbamoyl)-5-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 57333911) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl 3-(methylcarbamoyl)-5-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 3-(methylcarbamoyl)-5-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 57333911 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethyl 3-(methylcarbamoyl)-5-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(=O)NC)noc1-c1ccccc1 |
| InChI | InChI=1S/C14H14N2O4/c1-3-19-14(18)10-11(13(17)15-2)16-20-12(10)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3,(H,15,17) |
| InChIKey | ABTVVSROWHWQJR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |