C18H15NO3 — CID 100802140
ethyl 5-(4-phenylphenyl)-1,3-oxazole-4-carboxylate (PubChem CID 100802140) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 5-(4-phenylphenyl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(4-phenylphenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 100802140 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | ethyl 5-(4-phenylphenyl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncoc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15NO3/c1-2-21-18(20)16-17(22-12-19-16)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-12H,2H2,1H3 |
| InChIKey | YKINRFDNRMLKQQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |