C10H8INO3S — CID 79690999
ethyl 5-(5-iodothiophen-3-yl)-1,3-oxazole-4-carboxylate (PubChem CID 79690999) has the molecular formula C10H8INO3S and a molecular weight of 349.15 g/mol. Its IUPAC name is ethyl 5-(5-iodothiophen-3-yl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(5-iodothiophen-3-yl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 79690999 |
| Molecular Formula | C10H8INO3S |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | ethyl 5-(5-iodothiophen-3-yl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncoc1-c1csc(I)c1 |
| InChI | InChI=1S/C10H8INO3S/c1-2-14-10(13)8-9(15-5-12-8)6-3-7(11)16-4-6/h3-5H,2H2,1H3 |
| InChIKey | UYYOHSRIFQZIRI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|