C12H8ClF2NO3 — CID 82771967
ethyl 5-(4-chloro-2,5-difluorophenyl)-1,3-oxazole-4-carboxylate (PubChem CID 82771967) has the molecular formula C12H8ClF2NO3 and a molecular weight of 287.65 g/mol. Its IUPAC name is ethyl 5-(4-chloro-2,5-difluorophenyl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(4-chloro-2,5-difluorophenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 82771967 |
| Molecular Formula | C12H8ClF2NO3 |
| Molecular Weight | 287.65 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | ethyl 5-(4-chloro-2,5-difluorophenyl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncoc1-c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H8ClF2NO3/c1-2-18-12(17)10-11(19-5-16-10)6-3-9(15)7(13)4-8(6)14/h3-5H,2H2,1H3 |
| InChIKey | FPHXOLMIZVNAQP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|