(3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid

C12H12N2O3 — CID 68885744

IUPAC(3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid
SMILESCCc1noc(-c2ccccc2)c1NC(=O)O
InChIInChI=1S/C12H12N2O3/c1-2-9-10(13-12(15)16)11(17-14-9)8-6-4-3-5-7-8/h3-7,13H,2H2,1H3,(H,15,16)
InChIKeyHZPKZTBAXCVKLJ-UHFFFAOYSA-N
MW232.24 g/mol
LogP2.99
Rot. Bonds3

About (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid

(3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid (PubChem CID 68885744) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid.

Molecular Properties

Compound Name(3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid
PubChem CID68885744
Molecular FormulaC12H12N2O3
Molecular Weight232.24 g/mol
Exact Mass232.08
IUPAC Name(3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid
SMILESCCc1noc(-c2ccccc2)c1NC(=O)O
InChIInChI=1S/C12H12N2O3/c1-2-9-10(13-12(15)16)11(17-14-9)8-6-4-3-5-7-8/h3-7,13H,2H2,1H3,(H,15,16)
InChIKeyHZPKZTBAXCVKLJ-UHFFFAOYSA-N
XLogP2.99
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 52.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid?
The IUPAC name of (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid (CID 68885744) is (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid.
What is the SMILES notation for (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid?
The canonical SMILES for (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid is CCc1noc(-c2ccccc2)c1NC(=O)O.
What is the InChIKey of (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid?
The InChIKey is HZPKZTBAXCVKLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-2-9-10(13-12(15)16)11(17-14-9)8-6-4-3-5-7-8/h3-7,13H,2H2,1H3,(H,15,16).
What are the key properties of (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid?
(3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid has a molecular weight of 232.24 g/mol, XLogP of 2.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-5-phenyl-1,2-oxazol-4-yl)carbamic acid is sourced from PubChem (CID 68885744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).