C20H20N2O3S — CID 68883689
[3-methyl-5-[4-(2-phenylethylsulfanylmethyl)phenyl]-1,2-oxazol-4-yl]carbamic acid (PubChem CID 68883689) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is [3-methyl-5-[4-(2-phenylethylsulfanylmethyl)phenyl]-1,2-oxazol-4-yl]carbamic acid.
| Compound Name | [3-methyl-5-[4-(2-phenylethylsulfanylmethyl)phenyl]-1,2-oxazol-4-yl]carbamic acid |
|---|---|
| PubChem CID | 68883689 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [3-methyl-5-[4-(2-phenylethylsulfanylmethyl)phenyl]-1,2-oxazol-4-yl]carbamic acid |
| SMILES | Cc1noc(-c2ccc(CSCCc3ccccc3)cc2)c1NC(=O)O |
| InChI | InChI=1S/C20H20N2O3S/c1-14-18(21-20(23)24)19(25-22-14)17-9-7-16(8-10-17)13-26-12-11-15-5-3-2-4-6-15/h2-10,21H,11-13H2,1H3,(H,23,24) |
| InChIKey | KLKZGODMOSHSSP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|