C20H19ClN2O3 — CID 90769298
1-phenylethyl N-[5-[4-(chloromethyl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 90769298) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 1-phenylethyl N-[5-[4-(chloromethyl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | 1-phenylethyl N-[5-[4-(chloromethyl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 90769298 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-phenylethyl N-[5-[4-(chloromethyl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(-c2ccc(CCl)cc2)c1NC(=O)OC(C)c1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O3/c1-13-18(19(26-23-13)17-10-8-15(12-21)9-11-17)22-20(24)25-14(2)16-6-4-3-5-7-16/h3-11,14H,12H2,1-2H3,(H,22,24) |
| InChIKey | WYVCTAXVCKKARW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|